C14H6F6O3 — CID 172650695
3-(trifluoromethoxy)-5-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 172650695) has the molecular formula C14H6F6O3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-5-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 3-(trifluoromethoxy)-5-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 172650695 |
| Molecular Formula | C14H6F6O3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 3-(trifluoromethoxy)-5-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | O=C(O)c1cc(OC(F)(F)F)cc(-c2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H6F6O3/c15-10-4-7(5-11(16)12(10)17)6-1-8(13(21)22)3-9(2-6)23-14(18,19)20/h1-5H,(H,21,22) |
| InChIKey | FYNDUZWFDGAVGT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|