C22H21NO2 — CID 56974588
(4R)-4-benzyl-4-[(1S)-cyclohex-2-en-1-yl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 56974588) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (4R)-4-benzyl-4-[(1S)-cyclohex-2-en-1-yl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-benzyl-4-[(1S)-cyclohex-2-en-1-yl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 56974588 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (4R)-4-benzyl-4-[(1S)-cyclohex-2-en-1-yl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N[C@]1(Cc1ccccc1)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C22H21NO2/c24-21-22(19-14-8-3-9-15-19,16-17-10-4-1-5-11-17)23-20(25-21)18-12-6-2-7-13-18/h1-2,4-8,10-14,19H,3,9,15-16H2/t19-,22-/m1/s1 |
| InChIKey | LXQQEFHIKGLONX-DENIHFKCSA-N |
| XLogP | 4.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|