C14H26O5 — CID 56974897
dipropan-2-yl (2R,3S)-2-hydroxy-3-(2-methylpropyl)butanedioate (PubChem CID 56974897) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is dipropan-2-yl (2R,3S)-2-hydroxy-3-(2-methylpropyl)butanedioate.
| Compound Name | dipropan-2-yl (2R,3S)-2-hydroxy-3-(2-methylpropyl)butanedioate |
|---|---|
| PubChem CID | 56974897 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | dipropan-2-yl (2R,3S)-2-hydroxy-3-(2-methylpropyl)butanedioate |
| SMILES | CC(C)C[C@H](C(=O)OC(C)C)[C@@H](O)C(=O)OC(C)C |
| InChI | InChI=1S/C14H26O5/c1-8(2)7-11(13(16)18-9(3)4)12(15)14(17)19-10(5)6/h8-12,15H,7H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | BPPFWSKZWOAKRL-NWDGAFQWSA-N |
| XLogP | 1.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |