C8H9ClN2O3S — CID 56974975
2-(2-amino-2-oxoethyl)-1-chloro-4-(sulfinoamino)benzene (PubChem CID 56974975) has the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)-1-chloro-4-(sulfinoamino)benzene.
| Compound Name | 2-(2-amino-2-oxoethyl)-1-chloro-4-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 56974975 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)-1-chloro-4-(sulfinoamino)benzene |
| SMILES | NC(=O)Cc1cc(NS(=O)O)ccc1Cl |
| InChI | InChI=1S/C8H9ClN2O3S/c9-7-2-1-6(11-15(13)14)3-5(7)4-8(10)12/h1-3,11H,4H2,(H2,10,12)(H,13,14) |
| InChIKey | NCFYKRJQTHHAML-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|