C19H19F3O4S — CID 56976542
3-[4-(4-methylphenyl)-2-(trifluoromethyl)phenyl]sulfonylpropyl acetate (PubChem CID 56976542) has the molecular formula C19H19F3O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is 3-[4-(4-methylphenyl)-2-(trifluoromethyl)phenyl]sulfonylpropyl acetate.
| Compound Name | 3-[4-(4-methylphenyl)-2-(trifluoromethyl)phenyl]sulfonylpropyl acetate |
|---|---|
| PubChem CID | 56976542 |
| Molecular Formula | C19H19F3O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 3-[4-(4-methylphenyl)-2-(trifluoromethyl)phenyl]sulfonylpropyl acetate |
| SMILES | CC(=O)OCCCS(=O)(=O)c1ccc(-c2ccc(C)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3O4S/c1-13-4-6-15(7-5-13)16-8-9-18(17(12-16)19(20,21)22)27(24,25)11-3-10-26-14(2)23/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | LDUOZMXGNCDFAY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|