C9H16N4 — CID 56977113
3-piperidin-4-yl-4H-pyrimidin-2-amine (PubChem CID 56977113) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-piperidin-4-yl-4H-pyrimidin-2-amine.
| Compound Name | 3-piperidin-4-yl-4H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 56977113 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-piperidin-4-yl-4H-pyrimidin-2-amine |
| SMILES | NC1=NC=CCN1C1CCNCC1 |
| InChI | InChI=1S/C9H16N4/c10-9-12-4-1-7-13(9)8-2-5-11-6-3-8/h1,4,8,11H,2-3,5-7H2,(H2,10,12) |
| InChIKey | WHHMJTYWTVLIHJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |