About 1-diazenylheptan-2-one
1-diazenylheptan-2-one (PubChem CID 56977189) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-diazenylheptan-2-one.
Molecular Properties
| Compound Name | 1-diazenylheptan-2-one |
| PubChem CID | 56977189 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-diazenylheptan-2-one |
| SMILES | [H]/N=N/CC(=O)CCCCC |
| InChI | InChI=1S/C7H14N2O/c1-2-3-4-5-7(10)6-9-8/h8H,2-6H2,1H3/b9-8+ |
| InChIKey | RSGIFZBTGYOEMQ-CMDGGOBGSA-N |
| XLogP | 2.17 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-diazenylheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazenylheptan-2-one?
The IUPAC name of 1-diazenylheptan-2-one (CID 56977189) is 1-diazenylheptan-2-one.
What is the SMILES notation for 1-diazenylheptan-2-one?
The canonical SMILES for 1-diazenylheptan-2-one is [H]/N=N/CC(=O)CCCCC.
What is the InChIKey of 1-diazenylheptan-2-one?
The InChIKey is RSGIFZBTGYOEMQ-CMDGGOBGSA-N. The full InChI is InChI=1S/C7H14N2O/c1-2-3-4-5-7(10)6-9-8/h8H,2-6H2,1H3/b9-8+.
What are the key properties of 1-diazenylheptan-2-one?
1-diazenylheptan-2-one has a molecular weight of 142.20 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazenylheptan-2-one is sourced from PubChem (CID 56977189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).