C16H15ClN4 — CID 56979538
5-(4-chlorophenyl)-4-N-(4-methylphenyl)-1H-pyrazole-3,4-diamine (PubChem CID 56979538) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-N-(4-methylphenyl)-1H-pyrazole-3,4-diamine.
| Compound Name | 5-(4-chlorophenyl)-4-N-(4-methylphenyl)-1H-pyrazole-3,4-diamine |
|---|---|
| PubChem CID | 56979538 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-(4-chlorophenyl)-4-N-(4-methylphenyl)-1H-pyrazole-3,4-diamine |
| SMILES | Cc1ccc(Nc2c(N)n[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN4/c1-10-2-8-13(9-3-10)19-15-14(20-21-16(15)18)11-4-6-12(17)7-5-11/h2-9,19H,1H3,(H3,18,20,21) |
| InChIKey | GVVKFOHWXFKBHW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |