C69H60N4O12 — CID 56981133
bis[1-(1H-indol-3-ylmethoxy)-2-(1H-indol-3-ylmethyl)-1,3-dioxo-3-(2-phenylethoxy)propan-2-yl] 2-(2-phenylethyl)propanedioate (PubChem CID 56981133) has the molecular formula C69H60N4O12 and a molecular weight of 1137.26 g/mol. Its IUPAC name is bis[1-(1H-indol-3-ylmethoxy)-2-(1H-indol-3-ylmethyl)-1,3-dioxo-3-(2-phenylethoxy)propan-2-yl] 2-(2-phenylethyl)propanedioate.
| Compound Name | bis[1-(1H-indol-3-ylmethoxy)-2-(1H-indol-3-ylmethyl)-1,3-dioxo-3-(2-phenylethoxy)propan-2-yl] 2-(2-phenylethyl)propanedioate |
|---|---|
| PubChem CID | 56981133 |
| Molecular Formula | C69H60N4O12 |
| Molecular Weight | 1137.26 g/mol |
| Exact Mass | 1136.42 |
| IUPAC Name | bis[1-(1H-indol-3-ylmethoxy)-2-(1H-indol-3-ylmethyl)-1,3-dioxo-3-(2-phenylethoxy)propan-2-yl] 2-(2-phenylethyl)propanedioate |
| SMILES | O=C(OC(Cc1c[nH]c2ccccc12)(C(=O)OCCc1ccccc1)C(=O)OCc1c[nH]c2ccccc12)C(CCc1ccccc1)C(=O)OC(Cc1c[nH]c2ccccc12)(C(=O)OCCc1ccccc1)C(=O)OCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C69H60N4O12/c74-62(84-68(38-49-40-70-58-28-14-10-24-53(49)58,64(76)80-36-34-47-20-6-2-7-21-47)66(78)82-44-51-42-72-60-30-16-12-26-55(51)60)57(33-32-46-18-4-1-5-19-46)63(75)85-69(39-50-41-71-59-29-15-11-25-54(50)59,65(77)81-37-35-48-22-8-3-9-23-48)67(79)83-45-52-43-73-61-31-17-13-27-56(52)61/h1-31,40-43,57,70-73H,32-39,44-45H2 |
| InChIKey | QUHJLCPPWBAEDH-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 220.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1137.26 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|