C32H19N3O5 — CID 91432351
4,7,8-tris(1H-indol-3-yl)-1-oxaspiro[4.4]non-7-ene-2,3,6,9-tetrone (PubChem CID 91432351) has the molecular formula C32H19N3O5 and a molecular weight of 525.52 g/mol. Its IUPAC name is 4,7,8-tris(1H-indol-3-yl)-1-oxaspiro[4.4]non-7-ene-2,3,6,9-tetrone.
| Compound Name | 4,7,8-tris(1H-indol-3-yl)-1-oxaspiro[4.4]non-7-ene-2,3,6,9-tetrone |
|---|---|
| PubChem CID | 91432351 |
| Molecular Formula | C32H19N3O5 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 4,7,8-tris(1H-indol-3-yl)-1-oxaspiro[4.4]non-7-ene-2,3,6,9-tetrone |
| SMILES | O=C1OC2(C(=O)C(c3c[nH]c4ccccc34)=C(c3c[nH]c4ccccc34)C2=O)C(c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C32H19N3O5/c36-28-27(21-15-35-24-12-6-3-9-18(21)24)32(40-31(28)39)29(37)25(19-13-33-22-10-4-1-7-16(19)22)26(30(32)38)20-14-34-23-11-5-2-8-17(20)23/h1-15,27,33-35H |
| InChIKey | HEMPWPNLFYPWNJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|