C21H21N3O5S — CID 56982430
methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(4-nitrophenyl)-4,5-dihydropyrimidine-5-carboxylate (PubChem CID 56982430) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(4-nitrophenyl)-4,5-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(4-nitrophenyl)-4,5-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 56982430 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(4-nitrophenyl)-4,5-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1C(C)=NC(SCc2ccc(OC)cc2)=NC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-13-18(20(25)29-3)19(15-6-8-16(9-7-15)24(26)27)23-21(22-13)30-12-14-4-10-17(28-2)11-5-14/h4-11,18-19H,12H2,1-3H3 |
| InChIKey | WLVHMCMDZCVLAV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|