C22H20O2S — CID 56983264
4,4,4-triphenyl-3-sulfanylbutanoic acid (PubChem CID 56983264) has the molecular formula C22H20O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4,4,4-triphenyl-3-sulfanylbutanoic acid.
| Compound Name | 4,4,4-triphenyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 56983264 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4,4,4-triphenyl-3-sulfanylbutanoic acid |
| SMILES | O=C(O)CC(S)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O2S/c23-21(24)16-20(25)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,25H,16H2,(H,23,24) |
| InChIKey | RUTNUGUUYYOYKZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|