C17H20O8 — CID 21315531
5-methyl-5-phenylhexane-1,2,3,4-tetracarboxylic acid (PubChem CID 21315531) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is 5-methyl-5-phenylhexane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 5-methyl-5-phenylhexane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 21315531 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-methyl-5-phenylhexane-1,2,3,4-tetracarboxylic acid |
| SMILES | CC(C)(c1ccccc1)C(C(=O)O)C(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H20O8/c1-17(2,9-6-4-3-5-7-9)13(16(24)25)12(15(22)23)10(14(20)21)8-11(18)19/h3-7,10,12-13H,8H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | VGLLKSKULHKJHT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |