About (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate
(1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 56984803) has the molecular formula C21H38O2
and a molecular weight of 322.53 g/mol. Its IUPAC name is (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate |
| PubChem CID | 56984803 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)OC2(CCC)CCCCC2)CC1 |
| InChI | InChI=1S/C21H38O2/c1-3-5-7-10-18-11-13-19(14-12-18)20(22)23-21(15-4-2)16-8-6-9-17-21/h18-19H,3-17H2,1-2H3 |
| InChIKey | SQCZXDYLTWLMGD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate?
The IUPAC name of (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate (CID 56984803) is (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate.
What is the SMILES notation for (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate?
The canonical SMILES for (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate is CCCCCC1CCC(C(=O)OC2(CCC)CCCCC2)CC1.
What is the InChIKey of (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate?
The InChIKey is SQCZXDYLTWLMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O2/c1-3-5-7-10-18-11-13-19(14-12-18)20(22)23-21(15-4-2)16-8-6-9-17-21/h18-19H,3-17H2,1-2H3.
What are the key properties of (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate?
(1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate has a molecular weight of 322.53 g/mol, XLogP of 6.42, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylcyclohexyl) 4-pentylcyclohexane-1-carboxylate is sourced from PubChem (CID 56984803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).