C31H53NO2 — CID 150682012
(2-heptyl-1H-pyridin-2-yl) 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 150682012) has the molecular formula C31H53NO2 and a molecular weight of 471.77 g/mol. Its IUPAC name is (2-heptyl-1H-pyridin-2-yl) 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | (2-heptyl-1H-pyridin-2-yl) 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 150682012 |
| Molecular Formula | C31H53NO2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.41 |
| IUPAC Name | (2-heptyl-1H-pyridin-2-yl) 4-(4-hexylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCC1(OC(=O)C2CCC(C3CCC(CCCCCC)CC3)CC2)C=CC=CN1 |
| InChI | InChI=1S/C31H53NO2/c1-3-5-7-9-11-23-31(24-12-13-25-32-31)34-30(33)29-21-19-28(20-22-29)27-17-15-26(16-18-27)14-10-8-6-4-2/h12-13,24-29,32H,3-11,14-23H2,1-2H3 |
| InChIKey | JIBODIJGBAYNKN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|