C19H21N3O5 — CID 56985373
[methyl-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]carbamoyl] 3-phenylpropaneperoxoate (PubChem CID 56985373) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [methyl-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]carbamoyl] 3-phenylpropaneperoxoate.
| Compound Name | [methyl-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]carbamoyl] 3-phenylpropaneperoxoate |
|---|---|
| PubChem CID | 56985373 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [methyl-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]carbamoyl] 3-phenylpropaneperoxoate |
| SMILES | CN(CC(=O)NCc1ccncc1)C(=O)OOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O5/c1-22(14-17(23)21-13-16-9-11-20-12-10-16)19(25)27-26-18(24)8-7-15-5-3-2-4-6-15/h2-6,9-12H,7-8,13-14H2,1H3,(H,21,23) |
| InChIKey | QNIFKMIKXCFVFF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|