About [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate
[methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate (PubChem CID 57072344) has the molecular formula C22H26N2O5
and a molecular weight of 398.46 g/mol. Its IUPAC name is [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate.
Molecular Properties
| Compound Name | [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate |
| PubChem CID | 57072344 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate |
| SMILES | CN(CCc1ccccc1)C(=O)CN(C)C(=O)OOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O5/c1-23(16-15-19-11-7-4-8-12-19)20(25)17-24(2)22(27)29-28-21(26)14-13-18-9-5-3-6-10-18/h3-12H,13-17H2,1-2H3 |
| InChIKey | ZQWCDVQEICZTNO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate?
The IUPAC name of [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate (CID 57072344) is [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate.
What is the SMILES notation for [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate?
The canonical SMILES for [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate is CN(CCc1ccccc1)C(=O)CN(C)C(=O)OOC(=O)CCc1ccccc1.
What is the InChIKey of [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate?
The InChIKey is ZQWCDVQEICZTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O5/c1-23(16-15-19-11-7-4-8-12-19)20(25)17-24(2)22(27)29-28-21(26)14-13-18-9-5-3-6-10-18/h3-12H,13-17H2,1-2H3.
What are the key properties of [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate?
[methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate has a molecular weight of 398.46 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]carbamoyl] 3-phenylpropaneperoxoate is sourced from PubChem (CID 57072344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).