About [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate
[methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate (PubChem CID 57067194) has the molecular formula C18H25N3O6
and a molecular weight of 379.41 g/mol. Its IUPAC name is [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate.
Molecular Properties
| Compound Name | [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate |
| PubChem CID | 57067194 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate |
| SMILES | CN(CCC(=O)NN1CCOCC1)C(=O)OOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H25N3O6/c1-20(10-9-16(22)19-21-11-13-25-14-12-21)18(24)27-26-17(23)8-7-15-5-3-2-4-6-15/h2-6H,7-14H2,1H3,(H,19,22) |
| InChIKey | XQSTZONHCAEQKS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate?
The IUPAC name of [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate (CID 57067194) is [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate.
What is the SMILES notation for [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate?
The canonical SMILES for [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate is CN(CCC(=O)NN1CCOCC1)C(=O)OOC(=O)CCc1ccccc1.
What is the InChIKey of [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate?
The InChIKey is XQSTZONHCAEQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O6/c1-20(10-9-16(22)19-21-11-13-25-14-12-21)18(24)27-26-17(23)8-7-15-5-3-2-4-6-15/h2-6H,7-14H2,1H3,(H,19,22).
What are the key properties of [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate?
[methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate has a molecular weight of 379.41 g/mol, XLogP of 0.90, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[3-(morpholin-4-ylamino)-3-oxopropyl]carbamoyl] 3-phenylpropaneperoxoate is sourced from PubChem (CID 57067194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).