C9H10N2O — CID 56989365
5-nitroso-3,5,8,8a-tetrahydroisoquinoline (PubChem CID 56989365) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-nitroso-3,5,8,8a-tetrahydroisoquinoline.
| Compound Name | 5-nitroso-3,5,8,8a-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 56989365 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-nitroso-3,5,8,8a-tetrahydroisoquinoline |
| SMILES | O=NC1C=CCC2C=NCC=C21 |
| InChI | InChI=1S/C9H10N2O/c12-11-9-3-1-2-7-6-10-5-4-8(7)9/h1,3-4,6-7,9H,2,5H2 |
| InChIKey | CHXWDSMVNWNLNE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|