C9H10N2O — CID 57314763
5-nitroso-3,5,8,8a-tetrahydroquinoline (PubChem CID 57314763) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-nitroso-3,5,8,8a-tetrahydroquinoline.
| Compound Name | 5-nitroso-3,5,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 57314763 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-nitroso-3,5,8,8a-tetrahydroquinoline |
| SMILES | O=NC1C=CCC2N=CCC=C12 |
| InChI | InChI=1S/C9H10N2O/c12-11-9-5-1-4-8-7(9)3-2-6-10-8/h1,3,5-6,8-9H,2,4H2 |
| InChIKey | JHZMIXUOCOUAML-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|