C16H15ClNO4PS — CID 56990706
(4-chlorophenyl) [3-(2H-1,3-thiazol-3-ylmethyl)phenyl] hydrogen phosphate (PubChem CID 56990706) has the molecular formula C16H15ClNO4PS and a molecular weight of 383.79 g/mol. Its IUPAC name is (4-chlorophenyl) [3-(2H-1,3-thiazol-3-ylmethyl)phenyl] hydrogen phosphate.
| Compound Name | (4-chlorophenyl) [3-(2H-1,3-thiazol-3-ylmethyl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 56990706 |
| Molecular Formula | C16H15ClNO4PS |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (4-chlorophenyl) [3-(2H-1,3-thiazol-3-ylmethyl)phenyl] hydrogen phosphate |
| SMILES | O=P(O)(Oc1ccc(Cl)cc1)Oc1cccc(CN2C=CSC2)c1 |
| InChI | InChI=1S/C16H15ClNO4PS/c17-14-4-6-15(7-5-14)21-23(19,20)22-16-3-1-2-13(10-16)11-18-8-9-24-12-18/h1-10H,11-12H2,(H,19,20) |
| InChIKey | NVVZSQPNFCZIFH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|