C28H24ClO5P — CID 70605204
[4-[2-[(4-chlorophenyl)methyl]-3-oxo-3-phenylpropyl]phenyl] phenyl hydrogen phosphate (PubChem CID 70605204) has the molecular formula C28H24ClO5P and a molecular weight of 506.92 g/mol. Its IUPAC name is [4-[2-[(4-chlorophenyl)methyl]-3-oxo-3-phenylpropyl]phenyl] phenyl hydrogen phosphate.
| Compound Name | [4-[2-[(4-chlorophenyl)methyl]-3-oxo-3-phenylpropyl]phenyl] phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 70605204 |
| Molecular Formula | C28H24ClO5P |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | [4-[2-[(4-chlorophenyl)methyl]-3-oxo-3-phenylpropyl]phenyl] phenyl hydrogen phosphate |
| SMILES | O=C(c1ccccc1)C(Cc1ccc(Cl)cc1)Cc1ccc(OP(=O)(O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24ClO5P/c29-25-15-11-21(12-16-25)19-24(28(30)23-7-3-1-4-8-23)20-22-13-17-27(18-14-22)34-35(31,32)33-26-9-5-2-6-10-26/h1-18,24H,19-20H2,(H,31,32) |
| InChIKey | KTSGNLIZCUJNPL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|