C28H25ClNaO6P — CID 70605440
sodium;2-[(4-chlorophenyl)methyl]-3-(4-hydroxyphenyl)-1-phenylpropan-1-one;phenyl hydrogen phosphate (PubChem CID 70605440) has the molecular formula C28H25ClNaO6P and a molecular weight of 546.92 g/mol. Its IUPAC name is sodium;2-[(4-chlorophenyl)methyl]-3-(4-hydroxyphenyl)-1-phenylpropan-1-one;phenyl hydrogen phosphate.
| Compound Name | sodium;2-[(4-chlorophenyl)methyl]-3-(4-hydroxyphenyl)-1-phenylpropan-1-one;phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 70605440 |
| Molecular Formula | C28H25ClNaO6P |
| Molecular Weight | 546.92 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | sodium;2-[(4-chlorophenyl)methyl]-3-(4-hydroxyphenyl)-1-phenylpropan-1-one;phenyl hydrogen phosphate |
| SMILES | O=C(c1ccccc1)C(Cc1ccc(O)cc1)Cc1ccc(Cl)cc1.O=P([O-])(O)Oc1ccccc1.[Na+] |
| InChI | InChI=1S/C22H19ClO2.C6H7O4P.Na/c23-20-10-6-16(7-11-20)14-19(15-17-8-12-21(24)13-9-17)22(25)18-4-2-1-3-5-18;7-11(8,9)10-6-4-2-1-3-5-6;/h1-13,19,24H,14-15H2;1-5H,(H2,7,8,9);/q;;+1/p-1 |
| InChIKey | NEMFBLGXIFYTEI-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|