About 2-aminoethyl ethyl carbonate
2-aminoethyl ethyl carbonate (PubChem CID 56991737) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-aminoethyl ethyl carbonate.
Molecular Properties
| Compound Name | 2-aminoethyl ethyl carbonate |
| PubChem CID | 56991737 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 2-aminoethyl ethyl carbonate |
| SMILES | CCOC(=O)OCCN |
| InChI | InChI=1S/C5H11NO3/c1-2-8-5(7)9-4-3-6/h2-4,6H2,1H3 |
| InChIKey | ZDXWGHGCXKBHFM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl ethyl carbonate?
The IUPAC name of 2-aminoethyl ethyl carbonate (CID 56991737) is 2-aminoethyl ethyl carbonate.
What is the SMILES notation for 2-aminoethyl ethyl carbonate?
The canonical SMILES for 2-aminoethyl ethyl carbonate is CCOC(=O)OCCN.
What is the InChIKey of 2-aminoethyl ethyl carbonate?
The InChIKey is ZDXWGHGCXKBHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-2-8-5(7)9-4-3-6/h2-4,6H2,1H3.
What are the key properties of 2-aminoethyl ethyl carbonate?
2-aminoethyl ethyl carbonate has a molecular weight of 133.15 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl ethyl carbonate is sourced from PubChem (CID 56991737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).