C22H35F3O4 — CID 56992444
(2S)-2-cyclopentyl-2-(5-hydroxypent-3-enyl)-6-methyl-3-oxo-6-(trifluoromethyl)decanoic acid (PubChem CID 56992444) has the molecular formula C22H35F3O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-2-(5-hydroxypent-3-enyl)-6-methyl-3-oxo-6-(trifluoromethyl)decanoic acid.
| Compound Name | (2S)-2-cyclopentyl-2-(5-hydroxypent-3-enyl)-6-methyl-3-oxo-6-(trifluoromethyl)decanoic acid |
|---|---|
| PubChem CID | 56992444 |
| Molecular Formula | C22H35F3O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (2S)-2-cyclopentyl-2-(5-hydroxypent-3-enyl)-6-methyl-3-oxo-6-(trifluoromethyl)decanoic acid |
| SMILES | CCCCC(C)(CCC(=O)[C@@](CCC=CCO)(C(=O)O)C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C22H35F3O4/c1-3-4-13-20(2,22(23,24)25)15-12-18(27)21(19(28)29,14-8-5-9-16-26)17-10-6-7-11-17/h5,9,17,26H,3-4,6-8,10-16H2,1-2H3,(H,28,29)/t20?,21-/m0/s1 |
| InChIKey | GSCNRXIPIJAZSN-LBAQZLPGSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|