C27H43F3O5 — CID 70558479
(E,2R)-2-cyclopentyl-2-[(Z)-5-hydroxypent-3-enyl]-6-methyl-3-(oxan-2-yloxy)-6-(trifluoromethyl)dec-3-enoic acid (PubChem CID 70558479) has the molecular formula C27H43F3O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is (E,2R)-2-cyclopentyl-2-[(Z)-5-hydroxypent-3-enyl]-6-methyl-3-(oxan-2-yloxy)-6-(trifluoromethyl)dec-3-enoic acid.
| Compound Name | (E,2R)-2-cyclopentyl-2-[(Z)-5-hydroxypent-3-enyl]-6-methyl-3-(oxan-2-yloxy)-6-(trifluoromethyl)dec-3-enoic acid |
|---|---|
| PubChem CID | 70558479 |
| Molecular Formula | C27H43F3O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (E,2R)-2-cyclopentyl-2-[(Z)-5-hydroxypent-3-enyl]-6-methyl-3-(oxan-2-yloxy)-6-(trifluoromethyl)dec-3-enoic acid |
| SMILES | CCCCC(C)(C/C=C(/OC1CCCCO1)[C@](CC/C=C\CO)(C(=O)O)C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C27H43F3O5/c1-3-4-16-25(2,27(28,29)30)18-15-22(35-23-14-8-11-20-34-23)26(24(32)33,17-9-5-10-19-31)21-12-6-7-13-21/h5,10,15,21,23,31H,3-4,6-9,11-14,16-20H2,1-2H3,(H,32,33)/b10-5-,22-15+/t23?,25?,26-/m1/s1 |
| InChIKey | BHCXWPVJBSBFSO-VTYJZTKWSA-N |
| XLogP | 7.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|