C19H26O6 — CID 56992768
4-(1,2,3,4-tetramethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)butanoic acid (PubChem CID 56992768) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-(1,2,3,4-tetramethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)butanoic acid.
| Compound Name | 4-(1,2,3,4-tetramethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)butanoic acid |
|---|---|
| PubChem CID | 56992768 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-(1,2,3,4-tetramethoxy-5,6,8,9-tetrahydrobenzo[7]annulen-7-ylidene)butanoic acid |
| SMILES | COc1c2c(c(OC)c(OC)c1OC)CCC(=CCCC(=O)O)CC2 |
| InChI | InChI=1S/C19H26O6/c1-22-16-13-10-8-12(6-5-7-15(20)21)9-11-14(13)17(23-2)19(25-4)18(16)24-3/h6H,5,7-11H2,1-4H3,(H,20,21) |
| InChIKey | NIADDXTYFSPXQM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|