C22H29BrO5 — CID 56993125
(8S,9R,10S,13S,14S,17S)-9-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1-carbonyl bromide (PubChem CID 56993125) has the molecular formula C22H29BrO5 and a molecular weight of 453.37 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-9-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1-carbonyl bromide.
| Compound Name | (8S,9R,10S,13S,14S,17S)-9-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1-carbonyl bromide |
|---|---|
| PubChem CID | 56993125 |
| Molecular Formula | C22H29BrO5 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-9-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1-carbonyl bromide |
| SMILES | C[C@]12CC[C@@]3(O)[C@@H](CCC4=CC(=O)CC(C(=O)Br)[C@@]43C)[C@@H]1CC[C@@H]2C(=O)CO |
| InChI | InChI=1S/C22H29BrO5/c1-20-7-8-22(28)15(14(20)5-6-16(20)18(26)11-24)4-3-12-9-13(25)10-17(19(23)27)21(12,22)2/h9,14-17,24,28H,3-8,10-11H2,1-2H3/t14-,15-,16+,17?,20-,21+,22+/m0/s1 |
| InChIKey | GGWXGZFJBRJQAY-TVAXIDLOSA-N |
| XLogP | 2.96 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|