C23H37NO3S — CID 142124265
17-(2-hydroxyacetyl)-9,10,13-trimethyl-6-sulfanyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;methanamine (PubChem CID 142124265) has the molecular formula C23H37NO3S and a molecular weight of 407.62 g/mol. Its IUPAC name is 17-(2-hydroxyacetyl)-9,10,13-trimethyl-6-sulfanyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;methanamine.
| Compound Name | 17-(2-hydroxyacetyl)-9,10,13-trimethyl-6-sulfanyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;methanamine |
|---|---|
| PubChem CID | 142124265 |
| Molecular Formula | C23H37NO3S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 17-(2-hydroxyacetyl)-9,10,13-trimethyl-6-sulfanyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;methanamine |
| SMILES | CC12CCC3(C)C(CC(S)C4=CC(=O)CCC43C)C1CCC2C(=O)CO.CN |
| InChI | InChI=1S/C22H32O3S.CH5N/c1-20-8-9-22(3)16(14(20)4-5-15(20)18(25)12-23)11-19(26)17-10-13(24)6-7-21(17,22)2;1-2/h10,14-16,19,23,26H,4-9,11-12H2,1-3H3;2H2,1H3 |
| InChIKey | LWQNVBBKHOVMFF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|