C24H36O3 — CID 11917285
(8R,9R,10R,13S,14R,17S)-17-(2-hydroxyacetyl)-8,9,10,13,14-pentamethyl-2,6,7,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 11917285) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R,17S)-17-(2-hydroxyacetyl)-8,9,10,13,14-pentamethyl-2,6,7,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14R,17S)-17-(2-hydroxyacetyl)-8,9,10,13,14-pentamethyl-2,6,7,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11917285 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (8R,9R,10R,13S,14R,17S)-17-(2-hydroxyacetyl)-8,9,10,13,14-pentamethyl-2,6,7,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC3=CC(=O)CC[C@@]3(C)[C@@]1(C)CC[C@@]1(C)[C@@H](C(=O)CO)CC[C@@]21C |
| InChI | InChI=1S/C24H36O3/c1-20-9-7-17(26)14-16(20)6-10-24(5)22(3)11-8-18(19(27)15-25)21(22,2)12-13-23(20,24)4/h14,18,25H,6-13,15H2,1-5H3/t18-,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | LVQXUOUMCMUUEH-POTYRQCXSA-N |
| XLogP | 4.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |