C25H28N4O3 — CID 56993892
N-[(2S,3S)-1-[[(2S)-1-(1H-indol-3-yl)-5-oxopent-3-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]pyridine-2-carboxamide (PubChem CID 56993892) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(2S,3S)-1-[[(2S)-1-(1H-indol-3-yl)-5-oxopent-3-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[(2S,3S)-1-[[(2S)-1-(1H-indol-3-yl)-5-oxopent-3-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 56993892 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[(2S,3S)-1-[[(2S)-1-(1H-indol-3-yl)-5-oxopent-3-en-2-yl]amino]-3-methyl-1-oxopentan-2-yl]pyridine-2-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccn1)C(=O)N[C@H](C=CC=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H28N4O3/c1-3-17(2)23(29-24(31)22-12-6-7-13-26-22)25(32)28-19(9-8-14-30)15-18-16-27-21-11-5-4-10-20(18)21/h4-14,16-17,19,23,27H,3,15H2,1-2H3,(H,28,32)(H,29,31)/t17-,19+,23-/m0/s1 |
| InChIKey | ZHIJYXRKUQWCLL-GWJPWWOOSA-N |
| XLogP | 3.19 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|