C28H30N4O3 — CID 100924806
(2S,3R)-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-3-methyl-2-(naphthalen-1-ylcarbamoylamino)pentanamide (PubChem CID 100924806) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2S,3R)-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-3-methyl-2-(naphthalen-1-ylcarbamoylamino)pentanamide.
| Compound Name | (2S,3R)-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-3-methyl-2-(naphthalen-1-ylcarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 100924806 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2S,3R)-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]-3-methyl-2-(naphthalen-1-ylcarbamoylamino)pentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)Nc1cccc2ccccc12)C(=O)N[C@H](C=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H30N4O3/c1-3-18(2)26(32-28(35)31-25-14-8-10-19-9-4-5-11-22(19)25)27(34)30-21(17-33)15-20-16-29-24-13-7-6-12-23(20)24/h4-14,16-18,21,26,29H,3,15H2,1-2H3,(H,30,34)(H2,31,32,35)/t18-,21+,26+/m1/s1 |
| InChIKey | VIFRNMGMIPTJQJ-JDITYXQVSA-N |
| XLogP | 4.78 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|