C24H28N6O6 — CID 102461735
(2S,3S)-N-[(2S)-1-(hydroxyamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-methyl-2-[(2-nitrophenyl)carbamoylamino]pentanamide (PubChem CID 102461735) has the molecular formula C24H28N6O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is (2S,3S)-N-[(2S)-1-(hydroxyamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-methyl-2-[(2-nitrophenyl)carbamoylamino]pentanamide.
| Compound Name | (2S,3S)-N-[(2S)-1-(hydroxyamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-methyl-2-[(2-nitrophenyl)carbamoylamino]pentanamide |
|---|---|
| PubChem CID | 102461735 |
| Molecular Formula | C24H28N6O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (2S,3S)-N-[(2S)-1-(hydroxyamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-3-methyl-2-[(2-nitrophenyl)carbamoylamino]pentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)Nc1ccccc1[N+](=O)[O-])C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NO |
| InChI | InChI=1S/C24H28N6O6/c1-3-14(2)21(28-24(33)27-18-10-6-7-11-20(18)30(35)36)23(32)26-19(22(31)29-34)12-15-13-25-17-9-5-4-8-16(15)17/h4-11,13-14,19,21,25,34H,3,12H2,1-2H3,(H,26,32)(H,29,31)(H2,27,28,33)/t14-,19-,21-/m0/s1 |
| InChIKey | YWTQNEZRHNJWCI-JBYOLUDKSA-N |
| XLogP | 2.85 |
| TPSA | 178.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|