C13H16BrN3O2 — CID 56994426
(2S)-2-amino-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide (PubChem CID 56994426) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 56994426 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (2S)-2-amino-N-[(3-bromo-2,5-dihydro-1,2-oxazol-5-yl)methyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCC1C=C(Br)NO1 |
| InChI | InChI=1S/C13H16BrN3O2/c14-12-7-10(19-17-12)8-16-13(18)11(15)6-9-4-2-1-3-5-9/h1-5,7,10-11,17H,6,8,15H2,(H,16,18)/t10?,11-/m0/s1 |
| InChIKey | VCGTZHMFGJWCKS-DTIOYNMSSA-N |
| XLogP | 0.81 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|