C18H15FN6O3 — CID 56994874
7-fluoro-3-[3-(2-methoxypropan-2-yl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile (PubChem CID 56994874) has the molecular formula C18H15FN6O3 and a molecular weight of 382.36 g/mol. Its IUPAC name is 7-fluoro-3-[3-(2-methoxypropan-2-yl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile.
| Compound Name | 7-fluoro-3-[3-(2-methoxypropan-2-yl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile |
|---|---|
| PubChem CID | 56994874 |
| Molecular Formula | C18H15FN6O3 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 7-fluoro-3-[3-(2-methoxypropan-2-yl)-1,2,4-oxadiazol-5-yl]-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-6-carbonitrile |
| SMILES | COC(C)(C)c1noc(-c2ncn3c2c(C)[n+]([O-])c2c(C#N)c(F)ccc23)n1 |
| InChI | InChI=1S/C18H15FN6O3/c1-9-14-13(16-22-17(23-28-16)18(2,3)27-4)21-8-24(14)12-6-5-11(19)10(7-20)15(12)25(9)26/h5-6,8H,1-4H3 |
| InChIKey | WRGRHHBLARYOII-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|