C19H34O3Si — CID 56995888
methyl (4R)-4-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate (PubChem CID 56995888) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is methyl (4R)-4-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate.
| Compound Name | methyl (4R)-4-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate |
|---|---|
| PubChem CID | 56995888 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methyl (4R)-4-[(1R,7aR)-7a-methyl-4-trimethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pent-2-enoate |
| SMILES | COC(=O)C=C[C@@H](C)[C@H]1CCC2C(O[Si](C)(C)C)CCC[C@@]21C |
| InChI | InChI=1S/C19H34O3Si/c1-14(9-12-18(20)21-3)15-10-11-16-17(22-23(4,5)6)8-7-13-19(15,16)2/h9,12,14-17H,7-8,10-11,13H2,1-6H3/t14-,15-,16?,17?,19-/m1/s1 |
| InChIKey | RONFLRZZSWNCIO-OATWDJNDSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|