C6H11NO4 — CID 56997696
2-[(2,2-dihydroxyethylamino)methyl]prop-2-enoic acid (PubChem CID 56997696) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-[(2,2-dihydroxyethylamino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(2,2-dihydroxyethylamino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56997696 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 2-[(2,2-dihydroxyethylamino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNCC(O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-4(6(10)11)2-7-3-5(8)9/h5,7-9H,1-3H2,(H,10,11) |
| InChIKey | PHJKBPFCEJUXRR-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|