C7H13NO4 — CID 103256228
2-[(2,3-dihydroxypropylamino)methyl]prop-2-enoic acid (PubChem CID 103256228) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-[(2,3-dihydroxypropylamino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(2,3-dihydroxypropylamino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103256228 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-[(2,3-dihydroxypropylamino)methyl]prop-2-enoic acid |
| SMILES | C=C(CNCC(O)CO)C(=O)O |
| InChI | InChI=1S/C7H13NO4/c1-5(7(11)12)2-8-3-6(10)4-9/h6,8-10H,1-4H2,(H,11,12) |
| InChIKey | FVXJENLNHAEKPA-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|