4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid

C11H21NO4 — CID 82849273

IUPAC4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(CNCC(O)CO)CC1
InChIInChI=1S/C11H21NO4/c13-7-10(14)6-12-5-8-1-3-9(4-2-8)11(15)16/h8-10,12-14H,1-7H2,(H,15,16)
InChIKeyKXCKPVFZNONVTF-UHFFFAOYSA-N
MW231.29 g/mol
LogP-0.18
Rot. Bonds6

About 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid

4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 82849273) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid
PubChem CID82849273
Molecular FormulaC11H21NO4
Molecular Weight231.29 g/mol
Exact Mass231.15
IUPAC Name4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(CNCC(O)CO)CC1
InChIInChI=1S/C11H21NO4/c13-7-10(14)6-12-5-8-1-3-9(4-2-8)11(15)16/h8-10,12-14H,1-7H2,(H,15,16)
InChIKeyKXCKPVFZNONVTF-UHFFFAOYSA-N
XLogP-0.18
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 5-0.18
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid (CID 82849273) is 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(CNCC(O)CO)CC1.
What is the InChIKey of 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid?
The InChIKey is KXCKPVFZNONVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c13-7-10(14)6-12-5-8-1-3-9(4-2-8)11(15)16/h8-10,12-14H,1-7H2,(H,15,16).
What are the key properties of 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid?
4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid has a molecular weight of 231.29 g/mol, XLogP of -0.18, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-dihydroxypropylamino)methyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 82849273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).