C11H18BrNO2 — CID 79532642
4-[(2-bromoprop-2-enylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 79532642) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is 4-[(2-bromoprop-2-enylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-bromoprop-2-enylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79532642 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-[(2-bromoprop-2-enylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | C=C(Br)CNCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H18BrNO2/c1-8(12)6-13-7-9-2-4-10(5-3-9)11(14)15/h9-10,13H,1-7H2,(H,14,15) |
| InChIKey | GWOGJQUSGKDHPX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |