C20H18Si — CID 56997725
4-(9H-fluoren-9-yl)-6,6-dimethyl-6-silabicyclo[3.1.0]hexa-1(5),2-diene (PubChem CID 56997725) has the molecular formula C20H18Si and a molecular weight of 286.45 g/mol. Its IUPAC name is 4-(9H-fluoren-9-yl)-6,6-dimethyl-6-silabicyclo[3.1.0]hexa-1(5),2-diene.
| Compound Name | 4-(9H-fluoren-9-yl)-6,6-dimethyl-6-silabicyclo[3.1.0]hexa-1(5),2-diene |
|---|---|
| PubChem CID | 56997725 |
| Molecular Formula | C20H18Si |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(9H-fluoren-9-yl)-6,6-dimethyl-6-silabicyclo[3.1.0]hexa-1(5),2-diene |
| SMILES | C[Si]1(C)C2=C1C(C1c3ccccc3-c3ccccc31)C=C2 |
| InChI | InChI=1S/C20H18Si/c1-21(2)18-12-11-17(20(18)21)19-15-9-5-3-7-13(15)14-8-4-6-10-16(14)19/h3-12,17,19H,1-2H3 |
| InChIKey | BKJRZLWMJMFMRF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|