C20H34N2O — CID 56997885
N-[(3aS,3bS,9aR,9bR,11aS)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-ylidene]hydroxylamine (PubChem CID 56997885) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is N-[(3aS,3bS,9aR,9bR,11aS)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-ylidene]hydroxylamine.
| Compound Name | N-[(3aS,3bS,9aR,9bR,11aS)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 56997885 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | N-[(3aS,3bS,9aR,9bR,11aS)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-ylidene]hydroxylamine |
| SMILES | CC1CC2N(C)C(=NO)CC[C@]2(C)[C@@H]2CC[C@]3(C)CCC[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H34N2O/c1-13-12-16-20(3,11-8-17(21-23)22(16)4)15-7-10-19(2)9-5-6-14(19)18(13)15/h13-16,18,23H,5-12H2,1-4H3/t13?,14-,15+,16?,18-,19-,20+/m0/s1 |
| InChIKey | IINJEBOMEXAKSG-WPPIHUFCSA-N |
| XLogP | 4.75 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|