C17H20N2O5S2 — CID 56998216
N-[(3R,6S,7R)-2-formyl-3-methoxy-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide (PubChem CID 56998216) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(3R,6S,7R)-2-formyl-3-methoxy-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide.
| Compound Name | N-[(3R,6S,7R)-2-formyl-3-methoxy-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 56998216 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[(3R,6S,7R)-2-formyl-3-methoxy-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-7-yl]-2-phenoxyacetamide |
| SMILES | CO[C@]1(SC)CS[C@H]2[C@H](NC(=O)COc3ccccc3)C(=O)N2C1C=O |
| InChI | InChI=1S/C17H20N2O5S2/c1-23-17(25-2)10-26-16-14(15(22)19(16)12(17)8-20)18-13(21)9-24-11-6-4-3-5-7-11/h3-8,12,14,16H,9-10H2,1-2H3,(H,18,21)/t12?,14-,16+,17+/m1/s1 |
| InChIKey | XRTWESMFHUBWGR-NAJNRMEXSA-N |
| XLogP | 0.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|