C16H26O — CID 57000642
2-methyl-4-(2-methylhepta-1,4-dien-4-yloxy)hepta-1,4-diene (PubChem CID 57000642) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-methyl-4-(2-methylhepta-1,4-dien-4-yloxy)hepta-1,4-diene.
| Compound Name | 2-methyl-4-(2-methylhepta-1,4-dien-4-yloxy)hepta-1,4-diene |
|---|---|
| PubChem CID | 57000642 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-methyl-4-(2-methylhepta-1,4-dien-4-yloxy)hepta-1,4-diene |
| SMILES | C=C(C)CC(=CCC)OC(=CCC)CC(=C)C |
| InChI | InChI=1S/C16H26O/c1-7-9-15(11-13(3)4)17-16(10-8-2)12-14(5)6/h9-10H,3,5,7-8,11-12H2,1-2,4,6H3 |
| InChIKey | ILANVSRXMCOYMF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|