C20H29FN4 — CID 57000895
1-N-[4-(diethylamino)phenyl]-2-N,2-N-diethyl-5-fluorobenzene-1,2,4-triamine (PubChem CID 57000895) has the molecular formula C20H29FN4 and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-N-[4-(diethylamino)phenyl]-2-N,2-N-diethyl-5-fluorobenzene-1,2,4-triamine.
| Compound Name | 1-N-[4-(diethylamino)phenyl]-2-N,2-N-diethyl-5-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 57000895 |
| Molecular Formula | C20H29FN4 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 1-N-[4-(diethylamino)phenyl]-2-N,2-N-diethyl-5-fluorobenzene-1,2,4-triamine |
| SMILES | CCN(CC)c1ccc(Nc2cc(F)c(N)cc2N(CC)CC)cc1 |
| InChI | InChI=1S/C20H29FN4/c1-5-24(6-2)16-11-9-15(10-12-16)23-19-13-17(21)18(22)14-20(19)25(7-3)8-4/h9-14,23H,5-8,22H2,1-4H3 |
| InChIKey | ZOKAKLUYXRRHJW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|