C10H19NS — CID 57000948
N-ethyl-N-[(2-methyl-3H-thiophen-2-yl)methyl]ethanamine (PubChem CID 57000948) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is N-ethyl-N-[(2-methyl-3H-thiophen-2-yl)methyl]ethanamine.
| Compound Name | N-ethyl-N-[(2-methyl-3H-thiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 57000948 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-ethyl-N-[(2-methyl-3H-thiophen-2-yl)methyl]ethanamine |
| SMILES | CCN(CC)CC1(C)CC=CS1 |
| InChI | InChI=1S/C10H19NS/c1-4-11(5-2)9-10(3)7-6-8-12-10/h6,8H,4-5,7,9H2,1-3H3 |
| InChIKey | FFFRKORFOMKHPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |