C9H17NS — CID 57277605
N,N-diethyl-2-methyl-3H-thiophen-2-amine (PubChem CID 57277605) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-3H-thiophen-2-amine.
| Compound Name | N,N-diethyl-2-methyl-3H-thiophen-2-amine |
|---|---|
| PubChem CID | 57277605 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N,N-diethyl-2-methyl-3H-thiophen-2-amine |
| SMILES | CCN(CC)C1(C)CC=CS1 |
| InChI | InChI=1S/C9H17NS/c1-4-10(5-2)9(3)7-6-8-11-9/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | FAWZEMOYWOVSGZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |