C7H13NS — CID 123679768
3-methyl-4-prop-2-enyl-1,3-thiazolidine (PubChem CID 123679768) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 3-methyl-4-prop-2-enyl-1,3-thiazolidine.
| Compound Name | 3-methyl-4-prop-2-enyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 123679768 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 3-methyl-4-prop-2-enyl-1,3-thiazolidine |
| SMILES | C=CCC1CSCN1C |
| InChI | InChI=1S/C7H13NS/c1-3-4-7-5-9-6-8(7)2/h3,7H,1,4-6H2,2H3 |
| InChIKey | ALIVHLNMLHRGSS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|