C7H13NS — CID 56978141
N,N,2-trimethyl-3H-thiophen-2-amine (PubChem CID 56978141) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is N,N,2-trimethyl-3H-thiophen-2-amine.
| Compound Name | N,N,2-trimethyl-3H-thiophen-2-amine |
|---|---|
| PubChem CID | 56978141 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | N,N,2-trimethyl-3H-thiophen-2-amine |
| SMILES | CN(C)C1(C)CC=CS1 |
| InChI | InChI=1S/C7H13NS/c1-7(8(2)3)5-4-6-9-7/h4,6H,5H2,1-3H3 |
| InChIKey | HMCOABCELKDETL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |