C14H29NS — CID 142174144
4,4-dimethylpent-1-ene;3-methyl-4-propan-2-yl-1,3-thiazolidine (PubChem CID 142174144) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is 4,4-dimethylpent-1-ene;3-methyl-4-propan-2-yl-1,3-thiazolidine.
| Compound Name | 4,4-dimethylpent-1-ene;3-methyl-4-propan-2-yl-1,3-thiazolidine |
|---|---|
| PubChem CID | 142174144 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4,4-dimethylpent-1-ene;3-methyl-4-propan-2-yl-1,3-thiazolidine |
| SMILES | C=CCC(C)(C)C.CC(C)C1CSCN1C |
| InChI | InChI=1S/C7H15NS.C7H14/c1-6(2)7-4-9-5-8(7)3;1-5-6-7(2,3)4/h6-7H,4-5H2,1-3H3;5H,1,6H2,2-4H3 |
| InChIKey | ZUJAPBFCBXQVBS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|